C22H24N2O4S — CID 110560210
3-(furan-2-ylmethylsulfanyl)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110560210) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfanyl)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(furan-2-ylmethylsulfanyl)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560210 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-(furan-2-ylmethylsulfanyl)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(SCc2ccco2)=C(c2ccccc2)C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C22H24N2O4S/c25-21-19(17-6-2-1-3-7-17)20(29-16-18-8-4-13-28-18)22(26)24(21)10-5-9-23-11-14-27-15-12-23/h1-4,6-8,13H,5,9-12,14-16H2 |
| InChIKey | HNHXKAYZXXEASG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|