C23H23FN2O3S — CID 110544438
3-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-4-phenylsulfanylpyrrole-2,5-dione (PubChem CID 110544438) has the molecular formula C23H23FN2O3S and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-4-phenylsulfanylpyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-4-phenylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110544438 |
| Molecular Formula | C23H23FN2O3S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)-4-phenylsulfanylpyrrole-2,5-dione |
| SMILES | O=C1C(Sc2ccccc2)=C(c2ccc(F)cc2)C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C23H23FN2O3S/c24-18-9-7-17(8-10-18)20-21(30-19-5-2-1-3-6-19)23(28)26(22(20)27)12-4-11-25-13-15-29-16-14-25/h1-3,5-10H,4,11-16H2 |
| InChIKey | DLFHCEKQSRPEGA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|