C23H23F2N3O3 — CID 110586607
3-(3-fluoroanilino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione (PubChem CID 110586607) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-(3-fluoroanilino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586607 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 3-(3-fluoroanilino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2cccc(F)c2)=C(c2ccc(F)cc2)C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C23H23F2N3O3/c24-17-7-5-16(6-8-17)20-21(26-19-4-1-3-18(25)15-19)23(30)28(22(20)29)10-2-9-27-11-13-31-14-12-27/h1,3-8,15,26H,2,9-14H2 |
| InChIKey | CZQICTBNZOJQAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|