C23H23ClFN3O4 — CID 110586590
3-(3-chloro-4-methoxyanilino)-4-(4-fluorophenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione (PubChem CID 110586590) has the molecular formula C23H23ClFN3O4 and a molecular weight of 459.91 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyanilino)-4-(4-fluorophenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyanilino)-4-(4-fluorophenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586590 |
| Molecular Formula | C23H23ClFN3O4 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-(3-chloro-4-methoxyanilino)-4-(4-fluorophenyl)-1-(2-morpholin-4-ylethyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(c3ccc(F)cc3)C(=O)N(CCN3CCOCC3)C2=O)cc1Cl |
| InChI | InChI=1S/C23H23ClFN3O4/c1-31-19-7-6-17(14-18(19)24)26-21-20(15-2-4-16(25)5-3-15)22(29)28(23(21)30)9-8-27-10-12-32-13-11-27/h2-7,14,26H,8-13H2,1H3 |
| InChIKey | AWAFGELCCVRKBA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|