C24H24FN3O5 — CID 110544437
3-(1,3-benzodioxol-5-ylamino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione (PubChem CID 110544437) has the molecular formula C24H24FN3O5 and a molecular weight of 453.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110544437 |
| Molecular Formula | C24H24FN3O5 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-4-(4-fluorophenyl)-1-(3-morpholin-4-ylpropyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccc3c(c2)OCO3)=C(c2ccc(F)cc2)C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C24H24FN3O5/c25-17-4-2-16(3-5-17)21-22(26-18-6-7-19-20(14-18)33-15-32-19)24(30)28(23(21)29)9-1-8-27-10-12-31-13-11-27/h2-7,14,26H,1,8-13,15H2 |
| InChIKey | QTHPLRAYJXVJPT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|