C25H29N3O3 — CID 110594911
3-(3,5-dimethylanilino)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110594911) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-(3,5-dimethylanilino)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylanilino)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594911 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-(3,5-dimethylanilino)-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione |
| SMILES | Cc1cc(C)cc(NC2=C(c3ccccc3)C(=O)N(CCCN3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C25H29N3O3/c1-18-15-19(2)17-21(16-18)26-23-22(20-7-4-3-5-8-20)24(29)28(25(23)30)10-6-9-27-11-13-31-14-12-27/h3-5,7-8,15-17,26H,6,9-14H2,1-2H3 |
| InChIKey | AVSSGIGDEHMKBR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|