C22H15FN2O2S — CID 110543517
3-(4-fluorophenyl)-4-phenylsulfanyl-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110543517) has the molecular formula C22H15FN2O2S and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-phenylsulfanyl-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-4-phenylsulfanyl-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543517 |
| Molecular Formula | C22H15FN2O2S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3-(4-fluorophenyl)-4-phenylsulfanyl-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Sc2ccccc2)=C(c2ccc(F)cc2)C(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C22H15FN2O2S/c23-16-11-9-15(10-12-16)19-20(28-18-7-2-1-3-8-18)22(27)25(21(19)26)14-17-6-4-5-13-24-17/h1-13H,14H2 |
| InChIKey | JWCAOTICPHRWBP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|