C22H22FN3O3 — CID 110543515
3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110543515) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543515 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-(4-fluorophenyl)-4-[3-(hydroxymethyl)piperidin-1-yl]-1-(pyridin-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCCC(CO)C2)C(=O)N1Cc1ccccn1 |
| InChI | InChI=1S/C22H22FN3O3/c23-17-8-6-16(7-9-17)19-20(25-11-3-4-15(12-25)14-27)22(29)26(21(19)28)13-18-5-1-2-10-24-18/h1-2,5-10,15,27H,3-4,11-14H2 |
| InChIKey | OPWURMTWGOPOSN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|