C14H17NO3S2 — CID 110552906
1-butyl-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552906) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-butyl-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-butyl-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552906 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-butyl-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCCN1C(=O)C(SCCO)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C14H17NO3S2/c1-2-3-6-15-13(17)11(10-5-4-8-19-10)12(14(15)18)20-9-7-16/h4-5,8,16H,2-3,6-7,9H2,1H3 |
| InChIKey | OXMMTGNVXPBSAA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|