C19H19NO4S2 — CID 110551943
3-(2-hydroxyethylsulfanyl)-1-(3-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110551943) has the molecular formula C19H19NO4S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-1-(3-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-1-(3-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551943 |
| Molecular Formula | C19H19NO4S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-1-(3-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCOc1cccc(N2C(=O)C(SCCO)=C(c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C19H19NO4S2/c1-2-9-24-14-6-3-5-13(12-14)20-18(22)16(15-7-4-10-25-15)17(19(20)23)26-11-8-21/h3-7,10,12,21H,2,8-9,11H2,1H3 |
| InChIKey | XTBZFRRWKFBECH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|