C17H21NO5S2 — CID 11538214
3,4-bis(2-hydroxyethylsulfanyl)-1-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 11538214) has the molecular formula C17H21NO5S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3,4-bis(2-hydroxyethylsulfanyl)-1-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(2-hydroxyethylsulfanyl)-1-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11538214 |
| Molecular Formula | C17H21NO5S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 3,4-bis(2-hydroxyethylsulfanyl)-1-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)C(SCCO)=C(SCCO)C2=O)cc1 |
| InChI | InChI=1S/C17H21NO5S2/c1-2-9-23-13-5-3-12(4-6-13)18-16(21)14(24-10-7-19)15(17(18)22)25-11-8-20/h3-6,19-20H,2,7-11H2,1H3 |
| InChIKey | UIJJCUSONZFFIJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|