C16H11F2NO3S2 — CID 110555418
1-(3,4-difluorophenyl)-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555418) has the molecular formula C16H11F2NO3S2 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555418 |
| Molecular Formula | C16H11F2NO3S2 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(2-hydroxyethylsulfanyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2cccs2)C(=O)N1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H11F2NO3S2/c17-10-4-3-9(8-11(10)18)19-15(21)13(12-2-1-6-23-12)14(16(19)22)24-7-5-20/h1-4,6,8,20H,5,7H2 |
| InChIKey | WVHYHJAZSMLHSJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|