C18H14F3NO3S2 — CID 110552003
3-(2-hydroxyethylsulfanyl)-4-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione (PubChem CID 110552003) has the molecular formula C18H14F3NO3S2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-4-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-4-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552003 |
| Molecular Formula | C18H14F3NO3S2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-4-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2cccs2)C(=O)N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3NO3S2/c19-18(20,21)12-4-1-3-11(9-12)10-22-16(24)14(13-5-2-7-26-13)15(17(22)25)27-8-6-23/h1-5,7,9,23H,6,8,10H2 |
| InChIKey | NWKKKAFRXILRTA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|