C20H18N2O3S2 — CID 110552145
3-(2-hydroxyethylsulfanyl)-1-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552145) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-1-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-1-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552145 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-1-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2cccs2)C(=O)N1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H18N2O3S2/c23-9-11-27-18-17(16-6-3-10-26-16)19(24)22(20(18)25)8-7-13-12-21-15-5-2-1-4-14(13)15/h1-6,10,12,21,23H,7-9,11H2 |
| InChIKey | HNBBTKNBQRRKKH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|