C19H19N3OS2 — CID 135010471
(5S)-3-[2-(1H-indol-3-yl)ethyl]-5-methyl-2-sulfanylidene-1-(thiophen-2-ylmethyl)imidazolidin-4-one (PubChem CID 135010471) has the molecular formula C19H19N3OS2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (5S)-3-[2-(1H-indol-3-yl)ethyl]-5-methyl-2-sulfanylidene-1-(thiophen-2-ylmethyl)imidazolidin-4-one.
| Compound Name | (5S)-3-[2-(1H-indol-3-yl)ethyl]-5-methyl-2-sulfanylidene-1-(thiophen-2-ylmethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 135010471 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (5S)-3-[2-(1H-indol-3-yl)ethyl]-5-methyl-2-sulfanylidene-1-(thiophen-2-ylmethyl)imidazolidin-4-one |
| SMILES | C[C@H]1C(=O)N(CCc2c[nH]c3ccccc23)C(=S)N1Cc1cccs1 |
| InChI | InChI=1S/C19H19N3OS2/c1-13-18(23)21(19(24)22(13)12-15-5-4-10-25-15)9-8-14-11-20-17-7-3-2-6-16(14)17/h2-7,10-11,13,20H,8-9,12H2,1H3/t13-/m0/s1 |
| InChIKey | XIJXAOJGIFNQER-ZDUSSCGKSA-N |
| XLogP | 3.79 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|