C16H14N2OS4 — CID 102199025
5-(1,3-dithiolan-2-ylidene)-3-[2-(1H-indol-3-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 102199025) has the molecular formula C16H14N2OS4 and a molecular weight of 378.57 g/mol. Its IUPAC name is 5-(1,3-dithiolan-2-ylidene)-3-[2-(1H-indol-3-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,3-dithiolan-2-ylidene)-3-[2-(1H-indol-3-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 102199025 |
| Molecular Formula | C16H14N2OS4 |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 5-(1,3-dithiolan-2-ylidene)-3-[2-(1H-indol-3-yl)ethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=C2SCCS2)SC(=S)N1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H14N2OS4/c19-14-13(15-21-7-8-22-15)23-16(20)18(14)6-5-10-9-17-12-4-2-1-3-11(10)12/h1-4,9,17H,5-8H2 |
| InChIKey | OZAZLTMFFIGNOP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|