C20H20N2OS2 — CID 53494268
2-(1H-indol-3-yl)-N,N-bis(thiophen-2-ylmethyl)ethanamine oxide (PubChem CID 53494268) has the molecular formula C20H20N2OS2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-bis(thiophen-2-ylmethyl)ethanamine oxide.
| Compound Name | 2-(1H-indol-3-yl)-N,N-bis(thiophen-2-ylmethyl)ethanamine oxide |
|---|---|
| PubChem CID | 53494268 |
| Molecular Formula | C20H20N2OS2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-bis(thiophen-2-ylmethyl)ethanamine oxide |
| SMILES | [O-][N+](CCc1c[nH]c2ccccc12)(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C20H20N2OS2/c23-22(14-17-5-3-11-24-17,15-18-6-4-12-25-18)10-9-16-13-21-20-8-2-1-7-19(16)20/h1-8,11-13,21H,9-10,14-15H2 |
| InChIKey | FZKCXWITNADZDZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|