C19H24N4S — CID 111753311
1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111753311) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111753311 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-ethyl-3-[3-(1H-indol-3-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccs1)NCCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H24N4S/c1-2-20-19(23-14-16-8-6-12-24-16)21-11-5-7-15-13-22-18-10-4-3-9-17(15)18/h3-4,6,8-10,12-13,22H,2,5,7,11,14H2,1H3,(H2,20,21,23) |
| InChIKey | IFXXFPQSILXKGC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|