C15H23N5S — CID 111257617
1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111257617) has the molecular formula C15H23N5S and a molecular weight of 305.45 g/mol. Its IUPAC name is 1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111257617 |
| Molecular Formula | C15H23N5S |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccs1)NCCCc1cn[nH]c1C |
| InChI | InChI=1S/C15H23N5S/c1-3-16-15(18-11-14-7-5-9-21-14)17-8-4-6-13-10-19-20-12(13)2/h5,7,9-10H,3-4,6,8,11H2,1-2H3,(H,19,20)(H2,16,17,18) |
| InChIKey | LHBSSQSMUGTSBZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|