C10H18IN3S — CID 110914274
1,3-diethyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110914274) has the molecular formula C10H18IN3S and a molecular weight of 339.25 g/mol. Its IUPAC name is 1,3-diethyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110914274 |
| Molecular Formula | C10H18IN3S |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1,3-diethyl-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCNC(=NCc1cccs1)NCC.I |
| InChI | InChI=1S/C10H17N3S.HI/c1-3-11-10(12-4-2)13-8-9-6-5-7-14-9;/h5-7H,3-4,8H2,1-2H3,(H2,11,12,13);1H |
| InChIKey | OXZZPXYYVJSMBM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|