C8H14N4S — CID 116513135
1-amino-3-ethyl-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 116513135) has the molecular formula C8H14N4S and a molecular weight of 198.30 g/mol. Its IUPAC name is 1-amino-3-ethyl-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-amino-3-ethyl-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 116513135 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.30 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-amino-3-ethyl-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccs1)NN |
| InChI | InChI=1S/C8H14N4S/c1-2-10-8(12-9)11-6-7-4-3-5-13-7/h3-5H,2,6,9H2,1H3,(H2,10,11,12) |
| InChIKey | MGKXTTCWFOVBIU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|