C13H22N4OS — CID 111259245
3-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylpropanamide (PubChem CID 111259245) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111259245 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylpropanamide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCC(=O)N(C)C |
| InChI | InChI=1S/C13H22N4OS/c1-4-14-13(15-8-7-12(18)17(2)3)16-10-11-6-5-9-19-11/h5-6,9H,4,7-8,10H2,1-3H3,(H2,14,15,16) |
| InChIKey | QJUJJMVPUHALGJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|