C17H22BrIN4OS — CID 111259168
3-bromo-N-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111259168) has the molecular formula C17H22BrIN4OS and a molecular weight of 537.27 g/mol. Its IUPAC name is 3-bromo-N-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3-bromo-N-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111259168 |
| Molecular Formula | C17H22BrIN4OS |
| Molecular Weight | 537.27 g/mol |
| Exact Mass | 535.97 |
| IUPAC Name | 3-bromo-N-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCNC(=O)c1cccc(Br)c1.I |
| InChI | InChI=1S/C17H21BrN4OS.HI/c1-2-19-17(22-12-15-7-4-10-24-15)21-9-8-20-16(23)13-5-3-6-14(18)11-13;/h3-7,10-11H,2,8-9,12H2,1H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | ONCSTAYAZXECPJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|