C11H15N3S — CID 111260173
1-ethyl-3-prop-2-ynyl-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111260173) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-ynyl-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-prop-2-ynyl-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111260173 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-ethyl-3-prop-2-ynyl-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | C#CCN/C(=N/Cc1cccs1)NCC |
| InChI | InChI=1S/C11H15N3S/c1-3-7-13-11(12-4-2)14-9-10-6-5-8-15-10/h1,5-6,8H,4,7,9H2,2H3,(H2,12,13,14) |
| InChIKey | CHBWWYVVVAXSIQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|