C22H22N4O — CID 53494132
2-(1H-indol-3-yl)-N,N-bis(pyridin-2-ylmethyl)ethanamine oxide (PubChem CID 53494132) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-bis(pyridin-2-ylmethyl)ethanamine oxide.
| Compound Name | 2-(1H-indol-3-yl)-N,N-bis(pyridin-2-ylmethyl)ethanamine oxide |
|---|---|
| PubChem CID | 53494132 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-bis(pyridin-2-ylmethyl)ethanamine oxide |
| SMILES | [O-][N+](CCc1c[nH]c2ccccc12)(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C22H22N4O/c27-26(16-19-7-3-5-12-23-19,17-20-8-4-6-13-24-20)14-11-18-15-25-22-10-2-1-9-21(18)22/h1-10,12-13,15,25H,11,14,16-17H2 |
| InChIKey | AVVZLERUBDNOLA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|