C16H11ClFNO2S2 — CID 110554524
1-(3-chloro-4-fluorophenyl)-3-ethylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554524) has the molecular formula C16H11ClFNO2S2 and a molecular weight of 367.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-ethylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-ethylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554524 |
| Molecular Formula | C16H11ClFNO2S2 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-ethylsulfanyl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCSC1=C(c2cccs2)C(=O)N(c2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H11ClFNO2S2/c1-2-22-14-13(12-4-3-7-23-12)15(20)19(16(14)21)9-5-6-11(18)10(17)8-9/h3-8H,2H2,1H3 |
| InChIKey | IYEDFQXSJRSNOT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|