C22H23NO2S3 — CID 102447564
5-octyl-2-(5-thiophen-2-ylthiophen-2-yl)thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 102447564) has the molecular formula C22H23NO2S3 and a molecular weight of 429.63 g/mol. Its IUPAC name is 5-octyl-2-(5-thiophen-2-ylthiophen-2-yl)thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-octyl-2-(5-thiophen-2-ylthiophen-2-yl)thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 102447564 |
| Molecular Formula | C22H23NO2S3 |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 5-octyl-2-(5-thiophen-2-ylthiophen-2-yl)thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2cc(-c3ccc(-c4cccs4)s3)sc2C1=O |
| InChI | InChI=1S/C22H23NO2S3/c1-2-3-4-5-6-7-12-23-21(24)15-14-19(28-20(15)22(23)25)18-11-10-17(27-18)16-9-8-13-26-16/h8-11,13-14H,2-7,12H2,1H3 |
| InChIKey | NEJUCVIQBKSJNH-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|