C36H31N5O2S5 — CID 90175800
5-butyl-2-[7-[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 90175800) has the molecular formula C36H31N5O2S5 and a molecular weight of 726.01 g/mol. Its IUPAC name is 5-butyl-2-[7-[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-butyl-2-[7-[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 90175800 |
| Molecular Formula | C36H31N5O2S5 |
| Molecular Weight | 726.01 g/mol |
| Exact Mass | 725.11 |
| IUPAC Name | 5-butyl-2-[7-[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5cc6c(s5)C(=O)N(CCCC)C6=O)c5nsnc45)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C36H31N5O2S5/c1-3-5-7-8-9-20-10-15-26(44-20)21-11-12-22(31-30(21)37-47-38-31)27-16-17-28(45-27)23-13-14-24(33-32(23)39-48-40-33)29-19-25-34(46-29)36(43)41(35(25)42)18-6-4-2/h10-17,19H,3-9,18H2,1-2H3 |
| InChIKey | AATIEJFQHPPQMQ-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 88.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.01 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|