C21H26N2S2Si — CID 102290161
2-[4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]ethynyl-trimethylsilane (PubChem CID 102290161) has the molecular formula C21H26N2S2Si and a molecular weight of 398.67 g/mol. Its IUPAC name is 2-[4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 102290161 |
| Molecular Formula | C21H26N2S2Si |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[4-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-7-yl]ethynyl-trimethylsilane |
| SMILES | CCCCCCc1ccc(-c2ccc(C#C[Si](C)(C)C)c3nsnc23)s1 |
| InChI | InChI=1S/C21H26N2S2Si/c1-5-6-7-8-9-17-11-13-19(24-17)18-12-10-16(14-15-26(2,3)4)20-21(18)23-25-22-20/h10-13H,5-9H2,1-4H3 |
| InChIKey | AYMWGNHQYYWGCV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|