C56H46N4O2S6 — CID 102360094
4,11-bis[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione (PubChem CID 102360094) has the molecular formula C56H46N4O2S6 and a molecular weight of 999.41 g/mol. Its IUPAC name is 4,11-bis[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione.
| Compound Name | 4,11-bis[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
|---|---|
| PubChem CID | 102360094 |
| Molecular Formula | C56H46N4O2S6 |
| Molecular Weight | 999.41 g/mol |
| Exact Mass | 998.19 |
| IUPAC Name | 4,11-bis[5-[7-(5-hexylthiophen-2-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc5c(c4)C4C(=O)C(=O)C5c5cc(-c6ccc(-c7ccc(-c8ccc(CCCCCC)s8)c8nsnc78)s6)ccc54)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C56H46N4O2S6/c1-3-5-7-9-11-33-15-23-45(63-33)37-19-21-39(53-51(37)57-67-59-53)47-27-25-43(65-47)31-13-17-35-41(29-31)49-36-18-14-32(30-42(36)50(35)56(62)55(49)61)44-26-28-48(66-44)40-22-20-38(52-54(40)60-68-58-52)46-24-16-34(64-46)12-10-8-6-4-2/h13-30,49-50H,3-12H2,1-2H3 |
| InChIKey | SMXLSSLMCPSPQO-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.41 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|