C40H40S5 — CID 59489217
3,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]dibenzothiophene (PubChem CID 59489217) has the molecular formula C40H40S5 and a molecular weight of 681.10 g/mol. Its IUPAC name is 3,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]dibenzothiophene.
| Compound Name | 3,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]dibenzothiophene |
|---|---|
| PubChem CID | 59489217 |
| Molecular Formula | C40H40S5 |
| Molecular Weight | 681.10 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | 3,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]dibenzothiophene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc4c(c3)sc3cc(-c5ccc(-c6ccc(CCCCCC)s6)s5)ccc34)s2)s1 |
| InChI | InChI=1S/C40H40S5/c1-3-5-7-9-11-29-15-19-35(41-29)37-23-21-33(43-37)27-13-17-31-32-18-14-28(26-40(32)45-39(31)25-27)34-22-24-38(44-34)36-20-16-30(42-36)12-10-8-6-4-2/h13-26H,3-12H2,1-2H3 |
| InChIKey | FPTGUULNUWDBOA-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.10 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|