C36H36S7 — CID 86020599
4,10-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 86020599) has the molecular formula C36H36S7 and a molecular weight of 693.15 g/mol. Its IUPAC name is 4,10-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 86020599 |
| Molecular Formula | C36H36S7 |
| Molecular Weight | 693.15 g/mol |
| Exact Mass | 692.09 |
| IUPAC Name | 4,10-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc4sc5cc(-c6ccc(-c7ccc(CCCCCC)s7)s6)sc5c4s3)s2)s1 |
| InChI | InChI=1S/C36H36S7/c1-3-5-7-9-11-23-13-15-25(37-23)27-17-19-29(39-27)31-21-33-35(42-31)36-34(41-33)22-32(43-36)30-20-18-28(40-30)26-16-14-24(38-26)12-10-8-6-4-2/h13-22H,3-12H2,1-2H3 |
| InChIKey | WRDLMUIMEWXPBB-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.15 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|