C26H24S4 — CID 71418336
2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1-benzothiophene (PubChem CID 71418336) has the molecular formula C26H24S4 and a molecular weight of 464.75 g/mol. Its IUPAC name is 2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1-benzothiophene.
| Compound Name | 2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 71418336 |
| Molecular Formula | C26H24S4 |
| Molecular Weight | 464.75 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-[5-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1-benzothiophene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4cc5ccccc5s4)s3)s2)s1 |
| InChI | InChI=1S/C26H24S4/c1-2-3-4-5-9-19-11-12-21(27-19)22-13-14-23(29-22)24-15-16-25(30-24)26-17-18-8-6-7-10-20(18)28-26/h6-8,10-17H,2-5,9H2,1H3 |
| InChIKey | KUAYGVHRYSVXSG-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.75 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|