C41H36S5 — CID 72567089
2-hexyl-5-[5-[5-[5-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene (PubChem CID 72567089) has the molecular formula C41H36S5 and a molecular weight of 689.07 g/mol. Its IUPAC name is 2-hexyl-5-[5-[5-[5-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene.
| Compound Name | 2-hexyl-5-[5-[5-[5-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 72567089 |
| Molecular Formula | C41H36S5 |
| Molecular Weight | 689.07 g/mol |
| Exact Mass | 688.14 |
| IUPAC Name | 2-hexyl-5-[5-[5-[5-[5-[4-[2-(4-methylphenyl)ethenyl]phenyl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(C=Cc7ccc(C)cc7)cc6)s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C41H36S5/c1-3-4-5-6-7-32-18-19-34(42-32)35-22-23-38(44-35)39-26-27-41(46-39)40-25-24-37(45-40)36-21-20-33(43-36)31-16-14-30(15-17-31)13-12-29-10-8-28(2)9-11-29/h8-27H,3-7H2,1-2H3 |
| InChIKey | UIXHATGNDIHELV-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.07 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|