C64H69NS4 — CID 59288529
9-butyl-3,6-bis[(E)-2-[4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]carbazole (PubChem CID 59288529) has the molecular formula C64H69NS4 and a molecular weight of 980.53 g/mol. Its IUPAC name is 9-butyl-3,6-bis[(E)-2-[4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]carbazole.
| Compound Name | 9-butyl-3,6-bis[(E)-2-[4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]carbazole |
|---|---|
| PubChem CID | 59288529 |
| Molecular Formula | C64H69NS4 |
| Molecular Weight | 980.53 g/mol |
| Exact Mass | 979.43 |
| IUPAC Name | 9-butyl-3,6-bis[(E)-2-[4-[5-(5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]carbazole |
| SMILES | CCCCCCCCc1ccc(-c2ccc(-c3ccc(/C=C/c4ccc5c(c4)c4cc(/C=C/c6ccc(-c7ccc(-c8ccc(CCCCCCCC)s8)s7)cc6)ccc4n5CCCC)cc3)s2)s1 |
| InChI | InChI=1S/C64H69NS4/c1-4-7-10-12-14-16-18-53-34-38-61(66-53)63-42-40-59(68-63)51-30-24-47(25-31-51)20-22-49-28-36-57-55(45-49)56-46-50(29-37-58(56)65(57)44-9-6-3)23-21-48-26-32-52(33-27-48)60-41-43-64(69-60)62-39-35-54(67-62)19-17-15-13-11-8-5-2/h20-43,45-46H,4-19,44H2,1-3H3/b22-20+,23-21+ |
| InChIKey | GWHYTNRIQKQWJB-DQPVQCHKSA-N |
| XLogP | 21.66 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.53 |
| LogP ≤ 5 | 21.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|