C50H62O4S2 — CID 59288573
2-[2-(2-hexoxyethoxy)ethyl]-5-[4-[(E)-2-[4-[(E)-2-[4-[5-[2-(2-hexoxyethoxy)ethyl]thiophen-2-yl]phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene (PubChem CID 59288573) has the molecular formula C50H62O4S2 and a molecular weight of 791.18 g/mol. Its IUPAC name is 2-[2-(2-hexoxyethoxy)ethyl]-5-[4-[(E)-2-[4-[(E)-2-[4-[5-[2-(2-hexoxyethoxy)ethyl]thiophen-2-yl]phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene.
| Compound Name | 2-[2-(2-hexoxyethoxy)ethyl]-5-[4-[(E)-2-[4-[(E)-2-[4-[5-[2-(2-hexoxyethoxy)ethyl]thiophen-2-yl]phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene |
|---|---|
| PubChem CID | 59288573 |
| Molecular Formula | C50H62O4S2 |
| Molecular Weight | 791.18 g/mol |
| Exact Mass | 790.41 |
| IUPAC Name | 2-[2-(2-hexoxyethoxy)ethyl]-5-[4-[(E)-2-[4-[(E)-2-[4-[5-[2-(2-hexoxyethoxy)ethyl]thiophen-2-yl]phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene |
| SMILES | CCCCCCOCCOCCc1ccc(-c2ccc(/C=C/c3ccc(/C=C/c4ccc(-c5ccc(CCOCCOCCCCCC)s5)cc4)cc3)cc2)s1 |
| InChI | InChI=1S/C50H62O4S2/c1-3-5-7-9-33-51-37-39-53-35-31-47-27-29-49(55-47)45-23-19-43(20-24-45)17-15-41-11-13-42(14-12-41)16-18-44-21-25-46(26-22-44)50-30-28-48(56-50)32-36-54-40-38-52-34-10-8-6-4-2/h11-30H,3-10,31-40H2,1-2H3/b17-15+,18-16+ |
| InChIKey | BHWWXBZNDJTPIL-YTEMWHBBSA-N |
| XLogP | 13.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.18 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|