C48H56S4 — CID 59288548
3-methyl-5-[5-[4-[(E)-2-[4-[5-(4-methyl-5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]phenyl]thiophen-2-yl]-2-octylthiophene (PubChem CID 59288548) has the molecular formula C48H56S4 and a molecular weight of 761.24 g/mol. Its IUPAC name is 3-methyl-5-[5-[4-[(E)-2-[4-[5-(4-methyl-5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]phenyl]thiophen-2-yl]-2-octylthiophene.
| Compound Name | 3-methyl-5-[5-[4-[(E)-2-[4-[5-(4-methyl-5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]phenyl]thiophen-2-yl]-2-octylthiophene |
|---|---|
| PubChem CID | 59288548 |
| Molecular Formula | C48H56S4 |
| Molecular Weight | 761.24 g/mol |
| Exact Mass | 760.33 |
| IUPAC Name | 3-methyl-5-[5-[4-[(E)-2-[4-[5-(4-methyl-5-octylthiophen-2-yl)thiophen-2-yl]phenyl]ethenyl]phenyl]thiophen-2-yl]-2-octylthiophene |
| SMILES | CCCCCCCCc1sc(-c2ccc(-c3ccc(/C=C/c4ccc(-c5ccc(-c6cc(C)c(CCCCCCCC)s6)s5)cc4)cc3)s2)cc1C |
| InChI | InChI=1S/C48H56S4/c1-5-7-9-11-13-15-17-41-35(3)33-47(49-41)45-31-29-43(51-45)39-25-21-37(22-26-39)19-20-38-23-27-40(28-24-38)44-30-32-46(52-44)48-34-36(4)42(50-48)18-16-14-12-10-8-6-2/h19-34H,5-18H2,1-4H3/b20-19+ |
| InChIKey | KLZCREZMLMDCIF-FMQUCBEESA-N |
| XLogP | 17.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.24 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|