C32H26S2 — CID 76573319
2-methyl-5-[4-[2-[4-[2-[4-(5-methylthiophen-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene (PubChem CID 76573319) has the molecular formula C32H26S2 and a molecular weight of 474.69 g/mol. Its IUPAC name is 2-methyl-5-[4-[2-[4-[2-[4-(5-methylthiophen-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene.
| Compound Name | 2-methyl-5-[4-[2-[4-[2-[4-(5-methylthiophen-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene |
|---|---|
| PubChem CID | 76573319 |
| Molecular Formula | C32H26S2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-methyl-5-[4-[2-[4-[2-[4-(5-methylthiophen-2-yl)phenyl]ethenyl]phenyl]ethenyl]phenyl]thiophene |
| SMILES | Cc1ccc(-c2ccc(C=Cc3ccc(C=Cc4ccc(-c5ccc(C)s5)cc4)cc3)cc2)s1 |
| InChI | InChI=1S/C32H26S2/c1-23-3-21-31(33-23)29-17-13-27(14-18-29)11-9-25-5-7-26(8-6-25)10-12-28-15-19-30(20-16-28)32-22-4-24(2)34-32/h3-22H,1-2H3 |
| InChIKey | GGEDIEUTCYSTAO-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|