C32H26S — CID 163655314
2-[4-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methyl]phenyl]-5-phenylthiophene (PubChem CID 163655314) has the molecular formula C32H26S and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-[4-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methyl]phenyl]-5-phenylthiophene.
| Compound Name | 2-[4-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methyl]phenyl]-5-phenylthiophene |
|---|---|
| PubChem CID | 163655314 |
| Molecular Formula | C32H26S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[4-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methyl]phenyl]-5-phenylthiophene |
| SMILES | Cc1ccc(/C=C/c2ccc(Cc3ccc(-c4ccc(-c5ccccc5)s4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26S/c1-24-7-9-25(10-8-24)11-12-26-13-15-27(16-14-26)23-28-17-19-30(20-18-28)32-22-21-31(33-32)29-5-3-2-4-6-29/h2-22H,23H2,1H3/b12-11+ |
| InChIKey | IPSAJWKASOHTOW-VAWYXSNFSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|