C36H40Br2S2 — CID 59288522
5-bromo-2-[(E)-2-[4-[4-[(E)-2-(5-bromo-3-hexylthiophen-2-yl)ethenyl]phenyl]phenyl]ethenyl]-3-hexylthiophene (PubChem CID 59288522) has the molecular formula C36H40Br2S2 and a molecular weight of 696.66 g/mol. Its IUPAC name is 5-bromo-2-[(E)-2-[4-[4-[(E)-2-(5-bromo-3-hexylthiophen-2-yl)ethenyl]phenyl]phenyl]ethenyl]-3-hexylthiophene.
| Compound Name | 5-bromo-2-[(E)-2-[4-[4-[(E)-2-(5-bromo-3-hexylthiophen-2-yl)ethenyl]phenyl]phenyl]ethenyl]-3-hexylthiophene |
|---|---|
| PubChem CID | 59288522 |
| Molecular Formula | C36H40Br2S2 |
| Molecular Weight | 696.66 g/mol |
| Exact Mass | 694.09 |
| IUPAC Name | 5-bromo-2-[(E)-2-[4-[4-[(E)-2-(5-bromo-3-hexylthiophen-2-yl)ethenyl]phenyl]phenyl]ethenyl]-3-hexylthiophene |
| SMILES | CCCCCCc1cc(Br)sc1/C=C/c1ccc(-c2ccc(/C=C/c3sc(Br)cc3CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C36H40Br2S2/c1-3-5-7-9-11-31-25-35(37)39-33(31)23-17-27-13-19-29(20-14-27)30-21-15-28(16-22-30)18-24-34-32(26-36(38)40-34)12-10-8-6-4-2/h13-26H,3-12H2,1-2H3/b23-17+,24-18+ |
| InChIKey | DHJZCGRNGZFRNT-GJHDBBOXSA-N |
| XLogP | 13.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.66 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|