C18H23BrS2 — CID 59141203
5-bromo-3-butyl-2-[(E)-2-(3-butylthiophen-2-yl)ethenyl]thiophene (PubChem CID 59141203) has the molecular formula C18H23BrS2 and a molecular weight of 383.42 g/mol. Its IUPAC name is 5-bromo-3-butyl-2-[(E)-2-(3-butylthiophen-2-yl)ethenyl]thiophene.
| Compound Name | 5-bromo-3-butyl-2-[(E)-2-(3-butylthiophen-2-yl)ethenyl]thiophene |
|---|---|
| PubChem CID | 59141203 |
| Molecular Formula | C18H23BrS2 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 5-bromo-3-butyl-2-[(E)-2-(3-butylthiophen-2-yl)ethenyl]thiophene |
| SMILES | CCCCc1ccsc1/C=C/c1sc(Br)cc1CCCC |
| InChI | InChI=1S/C18H23BrS2/c1-3-5-7-14-11-12-20-16(14)9-10-17-15(8-6-4-2)13-18(19)21-17/h9-13H,3-8H2,1-2H3/b10-9+ |
| InChIKey | VKBLAUCBOKFIOX-MDZDMXLPSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |