C25H40S — CID 143882637
3-hexyl-2-[(1E,3E)-3-methyl-5-propan-2-ylideneundeca-1,3-dienyl]thiophene (PubChem CID 143882637) has the molecular formula C25H40S and a molecular weight of 372.66 g/mol. Its IUPAC name is 3-hexyl-2-[(1E,3E)-3-methyl-5-propan-2-ylideneundeca-1,3-dienyl]thiophene.
| Compound Name | 3-hexyl-2-[(1E,3E)-3-methyl-5-propan-2-ylideneundeca-1,3-dienyl]thiophene |
|---|---|
| PubChem CID | 143882637 |
| Molecular Formula | C25H40S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 3-hexyl-2-[(1E,3E)-3-methyl-5-propan-2-ylideneundeca-1,3-dienyl]thiophene |
| SMILES | CCCCCCC(/C=C(C)/C=C/c1sccc1CCCCCC)=C(C)C |
| InChI | InChI=1S/C25H40S/c1-6-8-10-12-14-23-18-19-26-25(23)17-16-22(5)20-24(21(3)4)15-13-11-9-7-2/h16-20H,6-15H2,1-5H3/b17-16+,22-20+ |
| InChIKey | HBKIAHMKMOJGMK-UMRDTUAGSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|