C33H42Br3N3S3 — CID 122229494
2,4,6-tris(5-bromo-3-hexylthiophen-2-yl)-1,3,5-triazine (PubChem CID 122229494) has the molecular formula C33H42Br3N3S3 and a molecular weight of 816.63 g/mol. Its IUPAC name is 2,4,6-tris(5-bromo-3-hexylthiophen-2-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(5-bromo-3-hexylthiophen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 122229494 |
| Molecular Formula | C33H42Br3N3S3 |
| Molecular Weight | 816.63 g/mol |
| Exact Mass | 813.01 |
| IUPAC Name | 2,4,6-tris(5-bromo-3-hexylthiophen-2-yl)-1,3,5-triazine |
| SMILES | CCCCCCc1cc(Br)sc1-c1nc(-c2sc(Br)cc2CCCCCC)nc(-c2sc(Br)cc2CCCCCC)n1 |
| InChI | InChI=1S/C33H42Br3N3S3/c1-4-7-10-13-16-22-19-25(34)40-28(22)31-37-32(29-23(20-26(35)41-29)17-14-11-8-5-2)39-33(38-31)30-24(21-27(36)42-30)18-15-12-9-6-3/h19-21H,4-18H2,1-3H3 |
| InChIKey | BBISDEVILYFEHG-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.63 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|