C26H29Br2FN2S3 — CID 141270386
4,7-bis(5-bromo-3-hexylthiophen-2-yl)-5-fluoro-2,1,3-benzothiadiazole (PubChem CID 141270386) has the molecular formula C26H29Br2FN2S3 and a molecular weight of 644.54 g/mol. Its IUPAC name is 4,7-bis(5-bromo-3-hexylthiophen-2-yl)-5-fluoro-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(5-bromo-3-hexylthiophen-2-yl)-5-fluoro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 141270386 |
| Molecular Formula | C26H29Br2FN2S3 |
| Molecular Weight | 644.54 g/mol |
| Exact Mass | 641.98 |
| IUPAC Name | 4,7-bis(5-bromo-3-hexylthiophen-2-yl)-5-fluoro-2,1,3-benzothiadiazole |
| SMILES | CCCCCCc1cc(Br)sc1-c1cc(F)c(-c2sc(Br)cc2CCCCCC)c2nsnc12 |
| InChI | InChI=1S/C26H29Br2FN2S3/c1-3-5-7-9-11-16-13-20(27)32-25(16)18-15-19(29)22(24-23(18)30-34-31-24)26-17(14-21(28)33-26)12-10-8-6-4-2/h13-15H,3-12H2,1-2H3 |
| InChIKey | DTMHDECBFJUHSS-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.54 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|