C54H72Br2F2N2S5 — CID 88879922
4,7-bis[5-(5-bromo-4-octylthiophen-2-yl)-4-octylthiophen-2-yl]-5,6-difluoro-2,1,3-benzothiadiazole (PubChem CID 88879922) has the molecular formula C54H72Br2F2N2S5 and a molecular weight of 1107.32 g/mol. Its IUPAC name is 4,7-bis[5-(5-bromo-4-octylthiophen-2-yl)-4-octylthiophen-2-yl]-5,6-difluoro-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[5-(5-bromo-4-octylthiophen-2-yl)-4-octylthiophen-2-yl]-5,6-difluoro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 88879922 |
| Molecular Formula | C54H72Br2F2N2S5 |
| Molecular Weight | 1107.32 g/mol |
| Exact Mass | 1104.26 |
| IUPAC Name | 4,7-bis[5-(5-bromo-4-octylthiophen-2-yl)-4-octylthiophen-2-yl]-5,6-difluoro-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCc1cc(-c2sc(-c3c(F)c(F)c(-c4cc(CCCCCCCC)c(-c5cc(CCCCCCCC)c(Br)s5)s4)c4nsnc34)cc2CCCCCCCC)sc1Br |
| InChI | InChI=1S/C54H72Br2F2N2S5/c1-5-9-13-17-21-25-29-37-33-41(61-51(37)43-35-39(53(55)63-43)31-27-23-19-15-11-7-3)45-47(57)48(58)46(50-49(45)59-65-60-50)42-34-38(30-26-22-18-14-10-6-2)52(62-42)44-36-40(54(56)64-44)32-28-24-20-16-12-8-4/h33-36H,5-32H2,1-4H3 |
| InChIKey | VHYYYAGHCWAJQF-UHFFFAOYSA-N |
| XLogP | 22.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.32 |
| LogP ≤ 5 | 22.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|