C30H29NO2S2 — CID 141456371
5-[6-(5-formylthiophen-2-yl)-9-octylcarbazol-3-yl]thiophene-2-carbaldehyde (PubChem CID 141456371) has the molecular formula C30H29NO2S2 and a molecular weight of 499.70 g/mol. Its IUPAC name is 5-[6-(5-formylthiophen-2-yl)-9-octylcarbazol-3-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[6-(5-formylthiophen-2-yl)-9-octylcarbazol-3-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 141456371 |
| Molecular Formula | C30H29NO2S2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 5-[6-(5-formylthiophen-2-yl)-9-octylcarbazol-3-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCCCn1c2ccc(-c3ccc(C=O)s3)cc2c2cc(-c3ccc(C=O)s3)ccc21 |
| InChI | InChI=1S/C30H29NO2S2/c1-2-3-4-5-6-7-16-31-27-12-8-21(29-14-10-23(19-32)34-29)17-25(27)26-18-22(9-13-28(26)31)30-15-11-24(20-33)35-30/h8-15,17-20H,2-7,16H2,1H3 |
| InChIKey | YRPNNIQNQFPYGQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|