C39H46O2S2 — CID 90059203
5-[7-(5-formylthiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carbaldehyde (PubChem CID 90059203) has the molecular formula C39H46O2S2 and a molecular weight of 610.93 g/mol. Its IUPAC name is 5-[7-(5-formylthiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[7-(5-formylthiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 90059203 |
| Molecular Formula | C39H46O2S2 |
| Molecular Weight | 610.93 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 5-[7-(5-formylthiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3ccc(C=O)s3)ccc2-c2ccc(-c3ccc(C=O)s3)cc21 |
| InChI | InChI=1S/C39H46O2S2/c1-3-5-7-9-11-13-23-39(24-14-12-10-8-6-4-2)35-25-29(37-21-17-31(27-40)42-37)15-19-33(35)34-20-16-30(26-36(34)39)38-22-18-32(28-41)43-38/h15-22,25-28H,3-14,23-24H2,1-2H3 |
| InChIKey | SOAROIDTFGCPSL-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.93 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|