C39H46O4S2 — CID 101211871
5-[7-(5-carboxythiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carboxylic acid (PubChem CID 101211871) has the molecular formula C39H46O4S2 and a molecular weight of 642.93 g/mol. Its IUPAC name is 5-[7-(5-carboxythiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[7-(5-carboxythiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 101211871 |
| Molecular Formula | C39H46O4S2 |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | 5-[7-(5-carboxythiophen-2-yl)-9,9-dioctylfluoren-2-yl]thiophene-2-carboxylic acid |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3ccc(C(=O)O)s3)ccc2-c2ccc(-c3ccc(C(=O)O)s3)cc21 |
| InChI | InChI=1S/C39H46O4S2/c1-3-5-7-9-11-13-23-39(24-14-12-10-8-6-4-2)31-25-27(33-19-21-35(44-33)37(40)41)15-17-29(31)30-18-16-28(26-32(30)39)34-20-22-36(45-34)38(42)43/h15-22,25-26H,3-14,23-24H2,1-2H3,(H,40,41)(H,42,43) |
| InChIKey | YZTSISVYMVSFOG-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|