C27H34O4 — CID 23089428
9,9-dihexylfluorene-2,7-dicarboxylic acid (PubChem CID 23089428) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 9,9-dihexylfluorene-2,7-dicarboxylic acid.
| Compound Name | 9,9-dihexylfluorene-2,7-dicarboxylic acid |
|---|---|
| PubChem CID | 23089428 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 9,9-dihexylfluorene-2,7-dicarboxylic acid |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(=O)O)ccc2-c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C27H34O4/c1-3-5-7-9-15-27(16-10-8-6-4-2)23-17-19(25(28)29)11-13-21(23)22-14-12-20(26(30)31)18-24(22)27/h11-14,17-18H,3-10,15-16H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | NEXBMIFOQHWNDE-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|