9,9-dihexylfluorene-2,7-dicarboxylic acid

C27H34O4 — CID 23089428

IUPAC9,9-dihexylfluorene-2,7-dicarboxylic acid
SMILESCCCCCCC1(CCCCCC)c2cc(C(=O)O)ccc2-c2ccc(C(=O)O)cc21
InChIInChI=1S/C27H34O4/c1-3-5-7-9-15-27(16-10-8-6-4-2)23-17-19(25(28)29)11-13-21(23)22-14-12-20(26(30)31)18-24(22)27/h11-14,17-18H,3-10,15-16H2,1-2H3,(H,28,29)(H,30,31)
InChIKeyNEXBMIFOQHWNDE-UHFFFAOYSA-N
MW422.57 g/mol
LogP7.29
Rot. Bonds12

About 9,9-dihexylfluorene-2,7-dicarboxylic acid

9,9-dihexylfluorene-2,7-dicarboxylic acid (PubChem CID 23089428) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 9,9-dihexylfluorene-2,7-dicarboxylic acid.

Molecular Properties

Compound Name9,9-dihexylfluorene-2,7-dicarboxylic acid
PubChem CID23089428
Molecular FormulaC27H34O4
Molecular Weight422.57 g/mol
Exact Mass422.25
IUPAC Name9,9-dihexylfluorene-2,7-dicarboxylic acid
SMILESCCCCCCC1(CCCCCC)c2cc(C(=O)O)ccc2-c2ccc(C(=O)O)cc21
InChIInChI=1S/C27H34O4/c1-3-5-7-9-15-27(16-10-8-6-4-2)23-17-19(25(28)29)11-13-21(23)22-14-12-20(26(30)31)18-24(22)27/h11-14,17-18H,3-10,15-16H2,1-2H3,(H,28,29)(H,30,31)
InChIKeyNEXBMIFOQHWNDE-UHFFFAOYSA-N
XLogP7.29
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds12
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500422.57
LogP ≤ 57.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 9,9-dihexylfluorene-2,7-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9,9-dihexylfluorene-2,7-dicarboxylic acid?
The IUPAC name of 9,9-dihexylfluorene-2,7-dicarboxylic acid (CID 23089428) is 9,9-dihexylfluorene-2,7-dicarboxylic acid.
What is the SMILES notation for 9,9-dihexylfluorene-2,7-dicarboxylic acid?
The canonical SMILES for 9,9-dihexylfluorene-2,7-dicarboxylic acid is CCCCCCC1(CCCCCC)c2cc(C(=O)O)ccc2-c2ccc(C(=O)O)cc21.
What is the InChIKey of 9,9-dihexylfluorene-2,7-dicarboxylic acid?
The InChIKey is NEXBMIFOQHWNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34O4/c1-3-5-7-9-15-27(16-10-8-6-4-2)23-17-19(25(28)29)11-13-21(23)22-14-12-20(26(30)31)18-24(22)27/h11-14,17-18H,3-10,15-16H2,1-2H3,(H,28,29)(H,30,31).
What are the key properties of 9,9-dihexylfluorene-2,7-dicarboxylic acid?
9,9-dihexylfluorene-2,7-dicarboxylic acid has a molecular weight of 422.57 g/mol, XLogP of 7.29, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dihexylfluorene-2,7-dicarboxylic acid is sourced from PubChem (CID 23089428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).