C36H52O4 — CID 142837471
9-(4,8-dimethylnonyl)-9-(3,7-dimethyloctyl)fluorene-2,7-dicarboxylic acid (PubChem CID 142837471) has the molecular formula C36H52O4 and a molecular weight of 548.81 g/mol. Its IUPAC name is 9-(4,8-dimethylnonyl)-9-(3,7-dimethyloctyl)fluorene-2,7-dicarboxylic acid.
| Compound Name | 9-(4,8-dimethylnonyl)-9-(3,7-dimethyloctyl)fluorene-2,7-dicarboxylic acid |
|---|---|
| PubChem CID | 142837471 |
| Molecular Formula | C36H52O4 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | 9-(4,8-dimethylnonyl)-9-(3,7-dimethyloctyl)fluorene-2,7-dicarboxylic acid |
| SMILES | CC(C)CCCC(C)CCCC1(CCC(C)CCCC(C)C)c2cc(C(=O)O)ccc2-c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C36H52O4/c1-24(2)10-7-12-26(5)14-9-20-36(21-19-27(6)13-8-11-25(3)4)32-22-28(34(37)38)15-17-30(32)31-18-16-29(35(39)40)23-33(31)36/h15-18,22-27H,7-14,19-21H2,1-6H3,(H,37,38)(H,39,40) |
| InChIKey | TUBHBNRCUHMXQF-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |